Introduction:Basic information about CAS 400715-45-9|5-(2-methyl-1,3-thiazol-4-yl)thiophene-2-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(2-methyl-1,3-thiazol-4-yl)thiophene-2-carboxylic acid |
|---|
| CAS Number | 400715-45-9 | Molecular Weight | 225.28700 |
|---|
| Density | 1.446g/cm3 | Boiling Point | 434.4ºC at 760mmHg |
|---|
| Molecular Formula | C9H7NO2S2 | Melting Point | 200ºC |
|---|
| MSDS | / | Flash Point | 216.5ºC |
|---|
Names
| Name | 5-(2-methyl-1,3-thiazol-4-yl)thiophene-2-carboxylic acid |
|---|
Chemical & Physical Properties
| Density | 1.446g/cm3 |
|---|
| Boiling Point | 434.4ºC at 760mmHg |
|---|
| Melting Point | 200ºC |
|---|
| Molecular Formula | C9H7NO2S2 |
|---|
| Molecular Weight | 225.28700 |
|---|
| Flash Point | 216.5ºC |
|---|
| Exact Mass | 224.99200 |
|---|
| PSA | 106.67000 |
|---|
| LogP | 2.87820 |
|---|
| Index of Refraction | 1.659 |
|---|
| InChIKey | AEDWMWQOFJYAGN-UHFFFAOYSA-N |
|---|
| SMILES | Cc1nc(-c2ccc(C(=O)O)s2)cs1 |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|