Introduction:Basic information about CAS 128249-70-7|2,6-Bis[|4R|-4-phenyl-2-oxazolinyl]pyridine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,6-Bis[|4R|-4-phenyl-2-oxazolinyl]pyridine |
|---|
| CAS Number | 128249-70-7 | Molecular Weight | 369.416 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 600.4±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C23H19N3O2 | Melting Point | 171-175ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 316.9±31.5 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2,6-Bis[(4R)-4-phenyl-2-oxazolinyl]pyridine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 600.4±55.0 °C at 760 mmHg |
|---|
| Melting Point | 171-175ºC |
|---|
| Molecular Formula | C23H19N3O2 |
|---|
| Molecular Weight | 369.416 |
|---|
| Flash Point | 316.9±31.5 °C |
|---|
| Exact Mass | 369.147736 |
|---|
| PSA | 56.07000 |
|---|
| LogP | 3.43 |
|---|
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.674 |
|---|
| InChIKey | HLHBIMJNCKZZQO-SFTDATJTSA-N |
|---|
| SMILES | c1ccc(C2COC(c3cccc(C4=NC(c5ccccc5)CO4)n3)=N2)cc1 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| 2,6-Bis((R)-4-phenyl-4,5-dihydrooxazol-2-yl)pyridine |
| (R,R)-2,2'-(2,6-Pyridinediyl)bis(4-phenyl-2-oxazoline) |
| Pyridine, 2,6-bis[(4S)-4,5-dihydro-4-phenyl-2-oxazolyl]- |
| (4R)-4-phenyl-2-[6-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]pyridin-2-yl]-4,5-dihydro-1,3-oxazole |
| (R,R)-2,6-Bis(4-phenyl-2-oxazolin-2-yl)pyridine |
| 2,6-Bis[(4R)-phenyl-2-(oxazolin-2-yl)]pyridine |
| (R,R)-2,6-Bis(4,5-dihydro-4-phenyl-2-oxazolyl)pyridine |
| 2,6-Bis[4R-4-phenyl-2-oxazolinyl]pyridine |
| 2,6-Bis[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]pyridine |
| (R,R)-2,6-Bis(4-phenyl-2-oxazolinyl)pyridine |
| MFCD01863585 |