Introduction：Basic information about CAS 141846-57-3|1-Chloro-2-deoxy-3,5-di-O-toluoyl-L-ribose, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Chloro-2-deoxy-3,5-di-O-toluoyl-L-ribose |
|---|
| CAS Number | 141846-57-3 | Molecular Weight | 388.841 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 518.4±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H21ClO5 | Melting Point | 117-119ºC |
|---|
| MSDS | / | Flash Point | 185.6±29.1 °C |
|---|
Names
| Name | (2S,3R,5R)-5-Chloro-2-(((4-methylbenzoyl)oxy)-methyl)tetrahydrofuran-3-yl 4-methylbenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 518.4±50.0 °C at 760 mmHg |
|---|
| Melting Point | 117-119ºC |
|---|
| Molecular Formula | C21H21ClO5 |
|---|
| Molecular Weight | 388.841 |
|---|
| Flash Point | 185.6±29.1 °C |
|---|
| Exact Mass | 388.107758 |
|---|
| PSA | 61.83000 |
|---|
| LogP | 5.23 |
|---|
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.583 |
|---|
| InChIKey | FJHSYOMVMMNQJQ-CEXWTWQISA-N |
|---|
| SMILES | Cc1ccc(C(=O)OCC2OC(Cl)CC2OC(=O)c2ccc(C)cc2)cc1 |
|---|
| Storage condition | -20°C Freezer |
|---|
Synonyms
| 1-chloro-3,5-di-toluoyl-2-deoxy-L-ribose |
| 2-deoxy-3,5-di-O-p-toluoyl-D-erythro-pentofuranosyl chloride |
| Hoffer's chlorosugar |
| 1-Chloro-3,5-di-O-toluoyl-2-deoxy-L-ribofuranose |
| L-erythro-Pentofuranosyl chloride, 2-deoxy-, bis(4-methylbenzoate) |
| 2-Deoxy-3,5-di-O-p-toluoyl-a-L-ribofuranosyl Chloride |
| 1-Chloro-2-deoxy-3,5-di-O-toluoyl-L-ribofuranose |
| β-L-erythro-Pentofuranosyl chloride, 2-deoxy-, bis(4-methylbenzoate) |
| 2-Deoxy-3,5-bis-O-(4-methylbenzoyl)-β-L-erythro-pentofuranosyl chloride |
| 2-Deoxy-3,5-bis-O-(4-methylbenzoyl)-L-erythro-pentofuranosyl chloride |
| Chloro-3,5-di-O-toluoyl-2-deoxy-a-L-ribofuranose |
| 1-Chloro-2-deoxy-3,5-di-O-toluoyl-L-ribose |
