Introduction：Basic information about CAS 19457-55-7|6-Methyleneandrost-4-ene-3,17-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Methyleneandrost-4-ene-3,17-dione |
|---|
| CAS Number | 19457-55-7 | Molecular Weight | 298.419 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 450.8±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H26O2 | Melting Point | 164 °C(dec.) |
|---|
| MSDS | / | Flash Point | 168.0±25.7 °C |
|---|
| Symbol |
GHS08 | Signal Word | Warning |
|---|
Names
| Name | (8R,9S,10R,13S,14S)-10,13-dimethyl-6-methylidene-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 450.8±45.0 °C at 760 mmHg |
|---|
| Melting Point | 164 °C(dec.) |
|---|
| Molecular Formula | C20H26O2 |
|---|
| Molecular Weight | 298.419 |
|---|
| Flash Point | 168.0±25.7 °C |
|---|
| Exact Mass | 298.193268 |
|---|
| PSA | 34.14000 |
|---|
| LogP | 3.07 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.556 |
|---|
| InChIKey | KQRGETZTRARSMA-DAELLWKTSA-N |
|---|
| SMILES | C=C1CC2C3CCC(=O)C3(C)CCC2C2(C)CCC(=O)C=C12 |
|---|
Safety Information
| Symbol |
GHS08 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H361 |
|---|
| Precautionary Statements | P280 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| Androst-4-ene-3,17-dione, 6-methylene- |
| 6-methylenandrosta-4-ene-3,17-dione |
| 6-methylen-4-androsten-3,17-dione |
| Androst-4-ene-3,17-dione,6-methylene- |
| 6-methylenandrost-4-ene-3 |
| 1,2-Dihydro Exemestane |
| 6-Methyleneandrost-4-en-3,17-dione |
| 6-Methyleneandrost-4-ene-3,17-dione |
| 6-Methyleneandrost-4-ene-3,7-dione |
| 6-methylene-4-androstene-3,17-dione |
| 6-methylen-androst-4-ene-3,17-dione |
| 6-methylideneandrost-4-ene-3,17-dione |
