Introduction：Basic information about CAS 19717-79-4|Gallium(III)-phthalocyanine chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Gallium(III)-phthalocyanine chloride |
|---|
| CAS Number | 19717-79-4 | Molecular Weight | 617.69900 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C32H16ClGaN8 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | chloro[29H,31H-phthalocyanato(2-)-κN29,κN30,κN31,κN32]gallium(III) |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C32H16ClGaN8 |
|---|
| Molecular Weight | 617.69900 |
|---|
| Exact Mass | 616.04400 |
|---|
| PSA | 84.02000 |
|---|
| LogP | 1.77310 |
|---|
| InChIKey | PRMHOXAMWFXGCO-UHFFFAOYSA-M |
|---|
| SMILES | Cl[Ga]1n2c3c4ccccc4c2N=C2N=C(N=c4c5ccccc5c(n41)=NC1=NC(=N3)c3ccccc31)c1ccccc12 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| chlorogallium phthalocyanine |
| MFCD00192192 |
| gallium dichloride |
| gallium phthalocyanine chloride |
