Introduction：Basic information about CAS 197245-13-9|N-Bsmoc-glycine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-Bsmoc-glycine |
|---|
| CAS Number | 197245-13-9 | Molecular Weight | 297.28400 |
|---|
| Density | 1.533g/cm3 | Boiling Point | 619.3ºC at 760mmHg |
|---|
| Molecular Formula | C12H11NO6S | Melting Point | 161-163ºC |
|---|
| MSDS | / | Flash Point | 328.3ºC |
|---|
Names
| Name | n-bsmoc-glycine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.533g/cm3 |
|---|
| Boiling Point | 619.3ºC at 760mmHg |
|---|
| Melting Point | 161-163ºC |
|---|
| Molecular Formula | C12H11NO6S |
|---|
| Molecular Weight | 297.28400 |
|---|
| Flash Point | 328.3ºC |
|---|
| Exact Mass | 297.03100 |
|---|
| PSA | 118.15000 |
|---|
| LogP | 2.09730 |
|---|
| Vapour Pressure | 3.4E-16mmHg at 25°C |
|---|
| Index of Refraction | 1.62 |
|---|
| InChIKey | DBOLZWJIOHWPHC-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CNC(=O)OCC1=Cc2ccccc2S1(=O)=O |
|---|
Safety Information
Synonyms
| N-Bsmoc-glycine |
| Velpar |
| MFCD03792135 |
| BR-xanthone H |
| Velpar L |
| BsmocGlycine |
| Gridball |
| BR-xanthone A |
| Brushkiller |
| Bsmoc-Gly-OH |
| 1-methyl-3-cyclohexyl-6-dimethylamino-1,3,5-triazin-2,4-dione |
| Velpar weed killer |
| Caswell No. 271AA |
| HEXAZINONE |
