Introduction：Basic information about CAS 405175-79-3|(R)-4-N-Cbz-Piperazine-2-carboxylic acid methyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (R)-4-N-Cbz-Piperazine-2-carboxylic acid methyl ester |
|---|
| CAS Number | 405175-79-3 | Molecular Weight | 278.304 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 459.2±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H18N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 231.5±28.7 °C |
|---|
Names
| Name | (R)-1-Benzyl 3-methyl piperazine-1,3-dicarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 459.2±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H18N2O4 |
|---|
| Molecular Weight | 278.304 |
|---|
| Flash Point | 231.5±28.7 °C |
|---|
| Exact Mass | 278.126648 |
|---|
| PSA | 67.87000 |
|---|
| LogP | 1.42 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.556 |
|---|
| InChIKey | FYKXWBBQYZXPFB-GFCCVEGCSA-N |
|---|
| SMILES | COC(=O)C1CN(C(=O)OCc2ccccc2)CCN1 |
|---|
Synonyms
| (2R)-4-[(Benzyloxy)carbonyl]-2-methyl-2-piperazinecarboxylic acid |
| 1,3-Piperazinedicarboxylic acid, 3-methyl 1-(phenylmethyl) ester, (3R)- |
| 1-Benzyl 3-methyl (3R)-1,3-piperazinedicarboxylate |
| 1-O-benzyl 3-O-methyl (3R)-piperazine-1,3-dicarboxylate |
| 1,3-Piperazinedicarboxylic acid, 3-methyl-, 1-(phenylmethyl) ester, (3R)- |
| 1-Benzyl 3-methyl (3R)-piperazine-1,3-dicarboxylate |
