Introduction:Basic information about CAS 952188-00-0|N-[Ethyl-(2-pyridyl-5-ethyl) Pioglitazone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-[Ethyl-(2-pyridyl-5-ethyl) Pioglitazone |
|---|
| CAS Number | 952188-00-0 | Molecular Weight | 489.62900 |
|---|
| Density | 1.217g/cm3 | Boiling Point | 663.3ºC at 760 mmHg |
|---|
| Molecular Formula | C28H31N3O3S | Melting Point | 93 ºC |
|---|
| MSDS | / | Flash Point | 354.9ºC |
|---|
Names
| Name | 5-[[4-[2-(5-ethylpyridin-2-yl)ethoxy]phenyl]methyl]-3-[2-(5-ethylpyridin-2-yl)ethyl]-1,3-thiazolidine-2,4-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.217g/cm3 |
|---|
| Boiling Point | 663.3ºC at 760 mmHg |
|---|
| Melting Point | 93 ºC |
|---|
| Molecular Formula | C28H31N3O3S |
|---|
| Molecular Weight | 489.62900 |
|---|
| Flash Point | 354.9ºC |
|---|
| Exact Mass | 489.20900 |
|---|
| PSA | 97.69000 |
|---|
| LogP | 5.01000 |
|---|
| Index of Refraction | 1.612 |
|---|
| InChIKey | UICSFXCWECATJX-UHFFFAOYSA-N |
|---|
| SMILES | CCc1ccc(CCOc2ccc(CC3SC(=O)N(CCc4ccc(CC)cn4)C3=O)cc2)nc1 |
|---|
Synonyms
| UNII-0A40W8CWPF |
| Pioglitazone hydrochloride specified impurity C [EP] |
| Pioglitazone hydrochloride impurity,N-alkylpioglitazone-[USP] |
| 5-{4-[2-(5-ethyl-pyridin-2-yl)ethoxy]benzyl}-3-[2-(5-ethyl-pyridin-2-yl)ethyl]-1,3-thiazolidine-2,4-dione |
| N-(Ethyl-(2-pyridyl-5-ethyl)) pioglitazone |
| (+/-)-5-(4-(2-(5-Ethylpyridin-2-yl)ethoxy)benzyl)-3-(2-(5-ethylpyridin-2-yl)ethyl)thiazolidine-2,4-dione |
| N-[Ethyl-(2-pyridyl-5-ethyl) Pioglitazone(Pioglitazone Impurity) |
| N-[Ethyl-(2-pyridyl-5-ethyl) Pioglitazone |
| 5-[4-[2-(5-Ethylpyridin-2-yl)ethoxy]benzyl]-3-[2-(5-ethylpyridin-2-yl)ethyl]thiazolidine-2,4-dione |
| Pioglitazone Impurity 3 |