Introduction:Basic information about CAS 40276-09-3|1-(Benzyloxy)-2-[(E)-2-nitrovinyl]benzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(Benzyloxy)-2-[(E)-2-nitrovinyl]benzene |
|---|
| CAS Number | 40276-09-3 | Molecular Weight | 255.26900 |
|---|
| Density | 1.207g/cm3 | Boiling Point | 413.9ºC at 760 mmHg |
|---|
| Molecular Formula | C15H13NO3 | Melting Point | 71-75ºC(lit.) |
|---|
| MSDS | / | Flash Point | 179.9ºC |
|---|
Names
| Name | 1-(Benzyloxy)-2-[(E)-2-nitrovinyl]benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.207g/cm3 |
|---|
| Boiling Point | 413.9ºC at 760 mmHg |
|---|
| Melting Point | 71-75ºC(lit.) |
|---|
| Molecular Formula | C15H13NO3 |
|---|
| Molecular Weight | 255.26900 |
|---|
| Flash Point | 179.9ºC |
|---|
| Exact Mass | 255.09000 |
|---|
| PSA | 55.05000 |
|---|
| LogP | 4.03620 |
|---|
| Index of Refraction | 1.624 |
|---|
| InChIKey | SQPQKZLZYZFJBK-ZHACJKMWSA-N |
|---|
| SMILES | O=[N+]([O-])C=Cc1ccccc1OCc1ccccc1 |
|---|
Safety Information
| Hazard Codes | Xi,N |
|---|
| Risk Phrases | 41-51/53 |
|---|
| Safety Phrases | 26-36/37/39-61 |
|---|
| RIDADR | UN 3077 9/PG 3 |
|---|
| HS Code | 2909309090 |
|---|
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 3-Amino-2-benzyloxypyridine |
| 2-Benzyloxy-pyridin-3-ylamine |
| 1-benzyloxy-2-(2-nitrovinyl)benzene |
| Pyridine,3-amino-2-(benzyloxy)-(8CI) |
| 3-Amino-2-benzyloxy-pyridin |
| 2-(benzyloxy)pyridin-3-amine |
| MFCD00666927 |