Introduction：Basic information about CAS 5580-83-6|1-Bromo-2,3,4,5-tetrafluoro-6-nitrobenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Bromo-2,3,4,5-tetrafluoro-6-nitrobenzene |
|---|
| CAS Number | 5580-83-6 | Molecular Weight | 273.967 |
|---|
| Density | 2.0±0.1 g/cm3 | Boiling Point | 224.8±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6BrF4NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 89.7±25.9 °C |
|---|
Names
| Name | 1-Bromo-2,3,4,5-tetrafluoro-6-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.0±0.1 g/cm3 |
|---|
| Boiling Point | 224.8±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6BrF4NO2 |
|---|
| Molecular Weight | 273.967 |
|---|
| Flash Point | 89.7±25.9 °C |
|---|
| Exact Mass | 272.904846 |
|---|
| PSA | 45.82000 |
|---|
| LogP | 1.72 |
|---|
| Vapour Pressure | 0.1±0.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.514 |
|---|
| InChIKey | DPFGSQSFQOMGPT-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1c(F)c(F)c(F)c(F)c1Br |
|---|
Synonyms
| 1-Brom-2,3,4,5-tetrafluor-6-nitro-benzol |
| Benzene, 1-bromo-2,3,4,5-tetrafluoro-6-nitro- |
| N-(5-bromo-4,4-dimethyl-pentyl)-phthalimide |
| 6-Bromo-2,3,4,5-tetrafluoronitrobenzol |
| 1-Brom-3,4,5,6-tetrafluor-2-nitrobenzol |
| 1-Brom-2,2-dimethyl-5-phthalimidopentan |
| 2-Brom-3.4.5.6-tetrafluor-nitrobenzol |
| 1-Bromo-2,3,4,5-tetrafluoro-6-nitrobenzene |
| 1-bromo-2-nitrotetrafluorobenzene |
| 2-(5-bromo-4,4-dimethylpentyl)-1h-isoindole-1,3(2h)-dione |
| 2-Brom-tetrafluornitrobenzol |
