Introduction：Basic information about CAS 201802-15-5|4-Iodo-4',4''-dimethoxytriphenylamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Iodo-4',4''-dimethoxytriphenylamine |
|---|
| CAS Number | 201802-15-5 | Molecular Weight | 431.26700 |
|---|
| Density | 1.484g/cm3 | Boiling Point | 511.917ºC at 760 mmHg |
|---|
| Molecular Formula | C20H18INO2 | Melting Point | 111°C |
|---|
| MSDS | / | Flash Point | 263.398ºC |
|---|
Names
| Name | N-(4-iodophenyl)-4-methoxy-N-(4-methoxyphenyl)aniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.484g/cm3 |
|---|
| Boiling Point | 511.917ºC at 760 mmHg |
|---|
| Melting Point | 111°C |
|---|
| Molecular Formula | C20H18INO2 |
|---|
| Molecular Weight | 431.26700 |
|---|
| Flash Point | 263.398ºC |
|---|
| Exact Mass | 431.03800 |
|---|
| PSA | 21.70000 |
|---|
| LogP | 5.77820 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.653 |
|---|
| InChIKey | VGQDQJMYUYSINZ-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(N(c2ccc(I)cc2)c2ccc(OC)cc2)cc1 |
|---|
Synonyms
| I0776 |
| Benzenamine,4-iodo-N,N-bis(4-methoxyphenyl) |
| 4-Iodo-4',4''-dimethoxytriphenylamine |
| 4-Iodo-N,N-bis(4-methoxyphenyl)aniline |
| 4-Iodo-4',4''-diMethoxytriphenylaMine |
