Introduction：Basic information about CAS 267230-43-3|(3R,4R)-4,5-ISOPROPYLIDENEPENT-2-EN-3-OL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (3R,4R)-4,5-ISOPROPYLIDENEPENT-2-EN-3-OL |
|---|
| CAS Number | 267230-43-3 | Molecular Weight | 364.39300 |
|---|
| Density | 1.28g/cm3 | Boiling Point | 550.3ºC at 760mmHg |
|---|
| Molecular Formula | C18H24N2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 286.6ºC |
|---|
Names
| Name | (3S,4R)-4-{[(Benzyloxy)carbonyl]amino}-1-{[(2-methyl-2-propanyl)o xy]carbonyl}-3-pyrrolidinecarboxylic acid |
|---|
Chemical & Physical Properties
| Density | 1.28g/cm3 |
|---|
| Boiling Point | 550.3ºC at 760mmHg |
|---|
| Molecular Formula | C18H24N2O6 |
|---|
| Molecular Weight | 364.39300 |
|---|
| Flash Point | 286.6ºC |
|---|
| Exact Mass | 364.16300 |
|---|
| PSA | 108.66000 |
|---|
| LogP | 2.37520 |
|---|
| Vapour Pressure | 6.07E-13mmHg at 25°C |
|---|
| Index of Refraction | 1.569 |
|---|
| InChIKey | TXZPPCRYQXSVCL-KBPBESRZSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1CC(NC(=O)OCc2ccccc2)C(C(=O)O)C1 |
|---|
