Introduction：Basic information about CAS 192701-96-5|5-(4-chlorophenyl)-1-[(2,4-dichlorophenyl)methyl]pyrazole-3-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(4-chlorophenyl)-1-[(2,4-dichlorophenyl)methyl]pyrazole-3-carboxylic acid |
|---|
| CAS Number | 192701-96-5 | Molecular Weight | 381.64000 |
|---|
| Density | 1.47g/cm3 | Boiling Point | 587.5ºC at 760 mmHg |
|---|
| Molecular Formula | C17H11Cl3N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 309.1ºC |
|---|
Names
| Name | 5-(4-chlorophenyl)-1-[(2,4-dichlorophenyl)methyl]pyrazole-3-carboxylic acid |
|---|
Chemical & Physical Properties
| Density | 1.47g/cm3 |
|---|
| Boiling Point | 587.5ºC at 760 mmHg |
|---|
| Molecular Formula | C17H11Cl3N2O2 |
|---|
| Molecular Weight | 381.64000 |
|---|
| Flash Point | 309.1ºC |
|---|
| Exact Mass | 379.98900 |
|---|
| PSA | 55.12000 |
|---|
| LogP | 5.25680 |
|---|
| Vapour Pressure | 1.2E-14mmHg at 25°C |
|---|
| Index of Refraction | 1.662 |
|---|
| InChIKey | OQQIVTTVYFVGQR-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc(-c2ccc(Cl)cc2)n(Cc2ccc(Cl)cc2Cl)n1 |
|---|
