Introduction:Basic information about CAS 2103-95-9|4-(4-Bromophenyl)-2-thiazolethiol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(4-Bromophenyl)-2-thiazolethiol |
|---|
| CAS Number | 2103-95-9 | Molecular Weight | 272.18500 |
|---|
| Density | 1.768g/cm3 | Boiling Point | 376.2ºC at 760 mmHg |
|---|
| Molecular Formula | C9H6BrNS2 | Melting Point | 220-224ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 181.32ºC |
|---|
| Symbol | GHS05, GHS06 | Signal Word | Danger |
|---|
Names
| Name | 4-(4-bromophenyl)-3H-1,3-thiazole-2-thione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.768g/cm3 |
|---|
| Boiling Point | 376.2ºC at 760 mmHg |
|---|
| Melting Point | 220-224ºC |
|---|
| Molecular Formula | C9H6BrNS2 |
|---|
| Molecular Weight | 272.18500 |
|---|
| Flash Point | 181.32ºC |
|---|
| Exact Mass | 270.91300 |
|---|
| PSA | 79.93000 |
|---|
| LogP | 3.86130 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.783 |
|---|
| InChIKey | QNNMMIMBOFCDQK-UHFFFAOYSA-N |
|---|
| SMILES | S=c1[nH]c(-c2ccc(Br)cc2)cs1 |
|---|
Safety Information
| Symbol | GHS05, GHS06 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H301-H315-H318-H335 |
|---|
| Precautionary Statements | P261-P280-P301 + P310-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|
| Hazard Codes | Xn: Harmful; |
|---|
| Risk Phrases | 22-37/38-41 |
|---|
| Safety Phrases | 26-39 |
|---|
| RIDADR | UN 2811 6.1/PG 3 |
|---|
| HS Code | 2934100090 |
|---|
Customs
| HS Code | 2934100090 |
|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| 4-(p-Bromophenyl)-2-mercaptothiazole |
| 2-Mercapto-4-(p-bromophenyl)thiazole |
| 4-(4'-bromophenyl)-2-mercaptothiazole |
| 4-(4-Bromophenyl)-2-thiazolethiol |
| 4-(4-BROMOPHENYL)-1,3-THIAZOLE-2-THIOL |
| 4-(4-Bromophenyl)-2(3H)-thiazolethione |
| 2-mercapto-4-(4-bromophenyl)thiazole |
| 4-(4-bromo-phenyl)-3H-thiazole-2-thione |
| 2-Thiazolethiol,4-(p-bromophenyl)-(7CI,8CI) |