Introduction:Basic information about CAS 545-93-7|5-(2-bromoallyl)-5-isopropylbarbituric acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(2-bromoallyl)-5-isopropylbarbituric acid |
|---|
| CAS Number | 545-93-7 | Molecular Weight | 289.12600 |
|---|
| Density | 1.44g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C10H13BrN2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 5-(2-bromoprop-2-enyl)-5-propan-2-yl-1,3-diazinane-2,4,6-trione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.44g/cm3 |
|---|
| Molecular Formula | C10H13BrN2O3 |
|---|
| Molecular Weight | 289.12600 |
|---|
| Exact Mass | 288.01100 |
|---|
| PSA | 82.25000 |
|---|
| LogP | 1.84530 |
|---|
| Index of Refraction | 1.515 |
|---|
| InChIKey | KTGWBBOJAGDSHN-UHFFFAOYSA-N |
|---|
| SMILES | C=C(Br)CC1(C(C)C)C(=O)NC(=O)NC1=O |
|---|
Safety Information
| RIDADR | UN 3249 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 6.1(b) |
|---|
| HS Code | 2933540000 |
|---|
Customs
| HS Code | 2933540000 |
|---|
| Summary | 2933540000 other derivatives of malonylurea (barbituric acid); salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
|---|
Synonyms
| Kwietal |
| Noctal |
| Propaldon |
| Noctenal |
| 5-(2-bromo-allyl)-5-isopropyl-pyrimidine-2,4,6-trione |
| Ibomal |
| Quietalum |
| Propallylonal |
| 5-(2-bromoallyl)-5-isopropyl barbituric acid |
| Nostral |
| 5-(2-bromo-2-propenyl)-5-(1-methylethyl)-2,4,6(1H,3H,5H)-pyrimidinetrione |
| Ibomalum |
| 5-<2-Brom-allyl>-5-isopropyl-barbitursaeure |
| Quietal |