Introduction：Basic information about CAS 7332-27-6|amcinafide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | amcinafide |
|---|
| CAS Number | 7332-27-6 | Molecular Weight | 496.56700 |
|---|
| Density | 1.353 g/cm3 | Boiling Point | 650.507ºC at 760 mmHg |
|---|
| Molecular Formula | C29H33FO6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 347.214ºC |
|---|
Names
| Name | amcinafide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.353 g/cm3 |
|---|
| Boiling Point | 650.507ºC at 760 mmHg |
|---|
| Molecular Formula | C29H33FO6 |
|---|
| Molecular Weight | 496.56700 |
|---|
| Flash Point | 347.214ºC |
|---|
| Exact Mass | 496.22600 |
|---|
| PSA | 93.06000 |
|---|
| LogP | 3.55560 |
|---|
| Index of Refraction | 1.623 |
|---|
| InChIKey | HCKFPALGXKOOBK-NRYMJLQJSA-N |
|---|
| SMILES | CC1(c2ccccc2)OC2CC3C4CCC5=CC(=O)C=CC5(C)C4(F)C(O)CC3(C)C2(C(=O)CO)O1 |
|---|
Synonyms
| (R)-9-Fluoro-11beta,16alpha,17,21-tetrahydroxypregna-1,4-diene-3,20-dione cyclic 16,17-acetal with acetophenone |
| Amcinafide (USAN/INN) |
| SQ 15,112 |
| UNII-F0Q1D55E29 |
