Introduction：Basic information about CAS 121809-82-3|2-methyl-2-[4-[(3,4,5-trichlorophenyl)carbamoylamino]phenoxy]propanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-methyl-2-[4-[(3,4,5-trichlorophenyl)carbamoylamino]phenoxy]propanoic acid |
|---|
| CAS Number | 121809-82-3 | Molecular Weight | 417.67100 |
|---|
| Density | 1.524g/cm3 | Boiling Point | 479.6ºC at 760mmHg |
|---|
| Molecular Formula | C17H15Cl3N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 243.8ºC |
|---|
Names
| Name | 2-methyl-2-[4-[(3,4,5-trichlorophenyl)carbamoylamino]phenoxy]propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.524g/cm3 |
|---|
| Boiling Point | 479.6ºC at 760mmHg |
|---|
| Molecular Formula | C17H15Cl3N2O4 |
|---|
| Molecular Weight | 417.67100 |
|---|
| Flash Point | 243.8ºC |
|---|
| Exact Mass | 416.01000 |
|---|
| PSA | 91.15000 |
|---|
| LogP | 5.61940 |
|---|
| Vapour Pressure | 5.25E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.666 |
|---|
| InChIKey | RETXRBKBFDJBQS-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(Oc1ccc(NC(=O)Nc2cc(Cl)c(Cl)c(Cl)c2)cc1)C(=O)O |
|---|
Synonyms
| 4-(3,4,5-trichlorophenylureido)phenoxyisobutyric acid |
| 2-(4-(3,4,5-Trichlorophenylureido)phenoxy)-2-methylpropionic acid |
| Propanoic acid,2-methyl-2-(4-((((3,4,5-trichlorophenyl)amino)carbonyl)amino)phenoxy) |
| 2-Methyl-2-(4-((((3,4,5-trichlorophenyl)amino)carbonyl)amino)phenoxy)propanoic acid |
| L 345 |
