Introduction：Basic information about CAS 1219386-75-0|DL-Carnitine-d9 (chloride), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | DL-Carnitine-d9 (chloride) |
|---|
| CAS Number | 1219386-75-0 | Molecular Weight | 206.71500 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C7H7ClD9NO3 | Melting Point | 197-199°C |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | (3-carboxy-2-hydroxypropyl)-tris(trideuteriomethyl)azanium,chloride |
|---|
| Synonym | More Synonyms |
|---|
DL-Carnitine-d9 (chloride) BiologicalActivity
Chemical & Physical Properties
| Melting Point | 197-199°C |
|---|
| Molecular Formula | C7H7ClD9NO3 |
|---|
| Molecular Weight | 206.71500 |
|---|
| Exact Mass | 206.13800 |
|---|
| PSA | 60.36000 |
|---|
| InChIKey | JXXCENBLGFBQJM-KYRNGWDOSA-N |
|---|
| SMILES | C[N+](C)(C)CC(O)CC(=O)O.[Cl-] |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| dl Carnitine-d9 Chloride |
| Aplegin-d9 |
| DL-Carnitine-(trimethyl-d9) hydrochloride |
| Bicarnesine-d9 |
| (3-Carboxy-2-hydroxypropyl)(trimethyl-d9)ammonium Chloride |
| 3-Carboxy-2-hydroxy-N,N,N-(trimethyl-d9)-1-propanaminium Chloride |
| DL-Carnitine-d9 (chloride) |
