Introduction：Basic information about CAS 91-87-2|alpha-amyl cinnamaldehyde dimethyl acetal, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | alpha-amyl cinnamaldehyde dimethyl acetal |
|---|
| CAS Number | 91-87-2 | Molecular Weight | 248.36100 |
|---|
| Density | 0.959g/cm3 | Boiling Point | 341ºC at 760 mmHg |
|---|
| Molecular Formula | C16H24O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 119.9ºC |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | [(E)-2-(dimethoxymethyl)hept-1-enyl]benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.959g/cm3 |
|---|
| Boiling Point | 341ºC at 760 mmHg |
|---|
| Molecular Formula | C16H24O2 |
|---|
| Molecular Weight | 248.36100 |
|---|
| Flash Point | 119.9ºC |
|---|
| Exact Mass | 248.17800 |
|---|
| PSA | 18.46000 |
|---|
| LogP | 4.26920 |
|---|
| Index of Refraction | 1.513 |
|---|
| InChIKey | QCHZKUPVENJLAW-FYWRMAATSA-N |
|---|
| SMILES | CCCCCC(=Cc1ccccc1)C(OC)OC |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P305 + P351 + P338 |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26;S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| FEMA No. 2062 |
| EINECS 202-104-3 |
| Amylcinnamaldehyde dimethyl acetal |
| 1,1-Dimethoxy-2-benzylideneheptane |
| 1,1-Dimethoxy-2-amyl-3-phenyl-2-propene |
