Introduction：Basic information about CAS 68975-83-7|2-oxo-N-[3,3,5-trimethyl-5-[[2,4,6-trioxo-3,5-bis[[1,3,3-trimethyl-5-[(2-oxoaz, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-oxo-N-[3,3,5-trimethyl-5-[[2,4,6-trioxo-3,5-bis[[1,3,3-trimethyl-5-[(2-oxoazepane-1-carbonyl)amino]cyclohexyl]methyl]-1,3,5-triazinan-1-yl]methyl]cyclohexyl]azepane-1-carboxamide |
|---|
| CAS Number | 68975-83-7 | Molecular Weight | 1006.32000 |
|---|
| Density | 1.24g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C54H87N9O9 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-oxo-N-[3,3,5-trimethyl-5-[[2,4,6-trioxo-3,5-bis[[1,3,3-trimethyl-5-[(2-oxoazepane-1-carbonyl)amino]cyclohexyl]methyl]-1,3,5-triazinan-1-yl]methyl]cyclohexyl]azepane-1-carboxamide |
|---|
Chemical & Physical Properties
| Density | 1.24g/cm3 |
|---|
| Molecular Formula | C54H87N9O9 |
|---|
| Molecular Weight | 1006.32000 |
|---|
| Exact Mass | 1005.66000 |
|---|
| PSA | 224.70000 |
|---|
| LogP | 7.69020 |
|---|
| Index of Refraction | 1.593 |
|---|
| InChIKey | XAUGVXXNNOTSRJ-UHFFFAOYSA-N |
|---|
| SMILES | CC1(C)CC(NC(=O)N2CCCCCC2=O)CC(C)(Cn2c(=O)n(CC3(C)CC(NC(=O)N4CCCCCC4=O)CC(C)(C)C3)c(=O)n(CC3(C)CC(NC(=O)N4CCCCCC4=O)CC(C)(C)C3)c2=O)C1 |
|---|
