Introduction：Basic information about CAS 87547-04-4|2-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluoro-phe noxy]ac, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluoro-phe noxy]acetic acid |
|---|
| CAS Number | 87547-04-4 | Molecular Weight | 353.73000 |
|---|
| Density | 1.56g/cm3 | Boiling Point | 570.5ºC at 760 mmHg |
|---|
| Molecular Formula | C16H13ClFNO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 298.9ºC |
|---|
Names
| Name | flumiclorac |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.56g/cm3 |
|---|
| Boiling Point | 570.5ºC at 760 mmHg |
|---|
| Molecular Formula | C16H13ClFNO5 |
|---|
| Molecular Weight | 353.73000 |
|---|
| Flash Point | 298.9ºC |
|---|
| Exact Mass | 353.04700 |
|---|
| PSA | 83.91000 |
|---|
| LogP | 2.75130 |
|---|
| Index of Refraction | 1.635 |
|---|
| InChIKey | GQQIAHNFBAFBCS-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)COc1cc(N2C(=O)C3=C(CCCC3)C2=O)c(F)cc1Cl |
|---|
Safety Information
Customs
| HS Code | 2925190090 |
|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| Flumiclorac |
| Flumiclorac [ISO] |
| [2-chloro-5-(cyclohex-1-ene-1,2-dicarboximido)-4-fluororophenoxy]acetic acid |
| [2-chloro-5-(1,3-dioxo-1,3,4,5,6,7-hexahydro-2H-isoindol-2-yl)-4-fluorophenoxy]acetic acid |
| 2-chloro-4-fluoro-5-[(3,4,5,6-tetrahydro)phthalimido]phenoxyacetic acid |
| 2-[2-chloro-4-fluoro-5-(1,3,4,5,6,7-hexahydro-1,3-dioxo-2H-isoindol-2-yl)phenoxy]acetic acid |
| UNII-WA50E25M0I |
| 2-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenoxy]acetic acid |
| 2-(2-Chloro-5-(1,3-dioxo-4,5,6,7-tetrahydro-1H-isoindol-2(3H)-yl)-4-fluorophenoxy)acetic acid |
