Introduction：Basic information about CAS 30704-63-3|4-tert-butylphenol,formaldehyde,oxirane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-tert-butylphenol,formaldehyde,oxirane |
|---|
| CAS Number | 30704-63-3 | Molecular Weight | 224.29600 |
|---|
| Density | / | Boiling Point | 233.7ºC at 760 mmHg |
|---|
| Molecular Formula | C13H20O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 110.9ºC |
|---|
Names
| Name | 4-tert-butylphenol,formaldehyde,oxirane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 233.7ºC at 760 mmHg |
|---|
| Molecular Formula | C13H20O3 |
|---|
| Molecular Weight | 224.29600 |
|---|
| Flash Point | 110.9ºC |
|---|
| Exact Mass | 224.14100 |
|---|
| PSA | 49.83000 |
|---|
| LogP | 3.15730 |
|---|
| InChIKey | QNFSVAUTKVHJMU-UHFFFAOYSA-N |
|---|
| SMILES | C1CO1.C=O.CC(C)(C)c1ccc(O)cc1 |
|---|
Synonyms
| Formaldehyde p-tert-butylphenol ethylene oxide polymer |
| p-tert-Butylphenol,formaldehyde,oxirane polymer |
| Formaldehyde,polymer with p-tert-butylphenol and oxirane |
