Introduction：Basic information about CAS 35409-97-3|dichlorbenzuron, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | dichlorbenzuron |
|---|
| CAS Number | 35409-97-3 | Molecular Weight | 343.59200 |
|---|
| Density | 1.516 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C14H9Cl3N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | dichlorbenzuron |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.516 g/cm3 |
|---|
| Molecular Formula | C14H9Cl3N2O2 |
|---|
| Molecular Weight | 343.59200 |
|---|
| Exact Mass | 341.97300 |
|---|
| PSA | 61.69000 |
|---|
| LogP | 5.25650 |
|---|
| Index of Refraction | 1.661 |
|---|
| InChIKey | BTYQXKURSPAXLT-UHFFFAOYSA-N |
|---|
| SMILES | O=C(NC(=O)c1c(Cl)cccc1Cl)Nc1ccc(Cl)cc1 |
|---|
Synonyms
| PH 60-38 |
| 2,6-dichloro-N-[(4-chlorophenyl)carbamoyl]benzamide |
| 2,6-dichloro-N-[[(4-chlorophenyl)amino]carbonyl]benzamide |
| OMS 1803 |
| TH 6038 |
| 1-(4-chlorophenyl)-3-(2,6-dichlorobenzoyl)urea |
