Introduction：Basic information about CAS 20241-76-3|Disperse Blue 77, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Disperse Blue 77 |
|---|
| CAS Number | 20241-76-3 | Molecular Weight | 376.31900 |
|---|
| Density | 1.609 g/cm3 | Boiling Point | 625.9ºC at 760 mmHg |
|---|
| Molecular Formula | C20H12N2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 332.4ºC |
|---|
Names
| Name | Disperse Blue 77 |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.609 g/cm3 |
|---|
| Boiling Point | 625.9ºC at 760 mmHg |
|---|
| Molecular Formula | C20H12N2O6 |
|---|
| Molecular Weight | 376.31900 |
|---|
| Flash Point | 332.4ºC |
|---|
| Exact Mass | 376.07000 |
|---|
| PSA | 132.45000 |
|---|
| LogP | 4.12120 |
|---|
| Vapour Pressure | 2.92E-16mmHg at 25°C |
|---|
| Index of Refraction | 1.782 |
|---|
| InChIKey | DYALWCKAJBVSBZ-UHFFFAOYSA-N |
|---|
| SMILES | O=C1c2c(O)ccc(Nc3ccccc3)c2C(=O)c2c([N+](=O)[O-])ccc(O)c21 |
|---|
Synonyms
| 4-Anilino-5-nitrochrysazin |
| Einecs 243-632-4 |
| Blue BLF |
| 4-Anilino-1,8-dihydroxy-5-nitroanthraquinone |
| 1,8-dihydroxy-4-phenylamino-5-nitroanthraquinone |
| 1,8-dihydroxy-4-nitro-5-(phenylamino)anthraquinone |
| 1-Anilino-4,5-dihydroxy-8-nitroanthraquinone |
| Blue SE-BLF |
| Anthraquinone,1-anilino-4,5-dihydroxy-8-nitro |
