Introduction:Basic information about CAS 15332-99-7|Tris(isopropenyloxy)(vinyl)silane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tris(isopropenyloxy)(vinyl)silane |
|---|
| CAS Number | 15332-99-7 | Molecular Weight | 226.344 |
|---|
| Density | 0.9±0.1 g/cm3 | Boiling Point | 224.3±13.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H18O3Si | Melting Point | <0ºC |
|---|
| MSDS | / | Flash Point | 88.2±27.3 °C |
|---|
Names
| Name | vinyltriisopropenoxysilane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.9±0.1 g/cm3 |
|---|
| Boiling Point | 224.3±13.0 °C at 760 mmHg |
|---|
| Melting Point | <0ºC |
|---|
| Molecular Formula | C11H18O3Si |
|---|
| Molecular Weight | 226.344 |
|---|
| Flash Point | 88.2±27.3 °C |
|---|
| Exact Mass | 226.102524 |
|---|
| PSA | 27.69000 |
|---|
| LogP | 6.57 |
|---|
| Vapour Pressure | 0.1±0.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.447 |
|---|
| InChIKey | GBFVZTUQONJGSL-UHFFFAOYSA-N |
|---|
| SMILES | C=C[Si](OC(=C)C)(OC(=C)C)OC(=C)C |
|---|
| Storage condition | 2~8℃,Seal |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 10-36/37/38 |
|---|
| Safety Phrases | 16-26-36 |
|---|
| RIDADR | UN 1993 |
|---|
| HS Code | 2931900090 |
|---|
Customs
| HS Code | 2931900090 |
|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Tris(1-methylethenyloxy)(vinyl)silane |
| Vinyltris(isopropenyloxy)silane |
| Ethenyltris[(1-methylethenyl)oxy]silane |
| ethenyltris[(1-methylethenyl)oxy]-silan |
| Vinyltrisisopropenoxysilane |
| Vinyltrisopropenoxysilane |
| tris(isopropenyloxy)vinylsilane |
| Tris(isopropenyloxy)(vinyl)silane |
| silane, ethenyltris((1-methylethenyl)oxy)- |
| Silane, ethenyltris[(1-methylethenyl)oxy]- |
| tri(Isopropenyloxy)vinylsilane |
| ethenyl-tri(prop-1-en-2-yloxy)silane |