CAS 2695-37-6|Sodium 4-vinylbenzenesulfonate
Introduction：Basic information about CAS 2695-37-6|Sodium 4-vinylbenzenesulfonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Sodium 4-vinylbenzenesulfonate | ||
|---|---|---|---|
| CAS Number | 2695-37-6 | Molecular Weight | 206.194 |
| Density | 1.043 g/mL at 25 °C | Boiling Point | 111-112 °C |
| Molecular Formula | C8H7NaO3S | Melting Point | 151-154 °C |
| MSDS | ChineseUSA | Flash Point | 78 °F |
| Symbol | GHS05, GHS07 | Signal Word | Danger |
Names
| Name | sodium,4-ethenylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.043 g/mL at 25 °C |
|---|---|
| Boiling Point | 111-112 °C |
| Melting Point | 151-154 °C |
| Molecular Formula | C8H7NaO3S |
| Molecular Weight | 206.194 |
| Flash Point | 78 °F |
| Exact Mass | 206.001358 |
| PSA | 65.58000 |
| LogP | 2.31450 |
| Index of Refraction | n20/D 1.387 |
| InChIKey | XFTALRAZSCGSKN-UHFFFAOYSA-M |
| SMILES | C=Cc1ccc(S(=O)(=O)[O-])cc1.[Na+] |
| Stability | Stable. Incompatible with strong oxidizing agents. |
Safety Information
| Symbol | GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H315-H318-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37-S36-S36/37/39 |
| RIDADR | UN 1987 3/PG 3 |
| WGK Germany | 3 |
| HS Code | 2904100000 |
Customs
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
Articles11
More Articles| Protein corona of nanoparticles: distinct proteins regulate the cellular uptake. Biomacromolecules 16(4) , 1311-21, (2015) Understanding nanoparticle-protein interactions is a crucial issue in the development of targeted nanomaterial delivery. Besides unraveling the composition of the nanoparticle's protein coronas, disti... | |
| Influence of the electrostatic interactions in a Pickering emulsion polymerization for the synthesis of silica-polystyrene hybrid nanoparticles. J. Colloid. Interface Sci. 448 , 306-14, (2015) Silica-polystyrene hybrid nanoparticles were synthesized by Pickering emulsion polymerization. The coupling effect of initiator type and silica surface charge was studied to exhibit the predominant ro... | |
| Conjugated Polyelectrolyte-Induced Self-Assembly of Alkynylplatinum(II) 2,6-Bis(benzimidazol-2'-yl)pyridine Complexes. Chemistry 21 , 16434-47, (2015) Water-soluble cationic alkynylplatinum(II) 2,6-bis(benzimidazol-2'-yl)pyridine (bzimpy) complexes have been demonstrated to undergo supramolecular assembly with anionic polyelectrolytes in aqueous buf... |
Synonyms
| Sodium 4-vinylbenzenesulfonate hydrate |
| 4-STYRENESULFONIC ACID, SODIUM SALT |
| 4-Vinylbenzenesulfonic Acid Sodium Salt Hydrate |
| Sodium p-Styrenesulfonate |
| 4-Vinylbenzenesulfonic acid sodium salt |
| sodium 4-ethenylbenzenesulfonate |
| p-Vinylbenzenesulphonic acid sodium salt |
| MFCD03092905 |
| EINECS 220-266-3 |
| sodium styrene sulphonate |
| sodium 4-styrene sulfonate |
| p-styrenesulfonic acid sodium salt |
| sodium styrene sulfonate |
| sodium styrene-4-sulphonate |
| sodium p-styrene sulfonate |
| Styrene-4-sulfonic acid sodium salt |
| Sodium 4-vinylbenzenesulphonate |
| Benzenesulfonic acid, 4-ethenyl-, sodium salt |
| sodium 4-styrenesulfonate |
| Benzenesulfonic acid, 4-ethenyl-, sodium salt (1:1) |
| Sodium 4-vinylbenzenesulfonate |
