Introduction：Basic information about CAS 87-03-6|Rhoduline acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Rhoduline acid |
|---|
| CAS Number | 87-03-6 | Molecular Weight | 461.46500 |
|---|
| Density | 1.734 | Boiling Point | / |
|---|
| Molecular Formula | C20H15NO8S2 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | / |
|---|
Names
| Name | 4-hydroxy-7-[(5-hydroxy-7-sulfonaphthalen-2-yl)amino]naphthalene-2-sulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.734 |
|---|
| Molecular Formula | C20H15NO8S2 |
|---|
| Molecular Weight | 461.46500 |
|---|
| Exact Mass | 461.02400 |
|---|
| PSA | 177.99000 |
|---|
| LogP | 5.87580 |
|---|
| Index of Refraction | 1.802 |
|---|
| InChIKey | BQVLLTHCZQAJNH-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(O)c1cc(O)c2ccc(Nc3ccc4c(O)cc(S(=O)(=O)O)cc4c3)cc2c1 |
|---|
Safety Information
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| I Acid Imide |
| 6,6'-Iminobis(1-hydroxy-3-sulfonaphthalene) |
| Di-J acid |
| Rhoduline Acid |
| 2,2-DIMETHYL-6-NITRO-CHROMAN-4-ONE |
| 4,4'-Dihydroxy-7,7'-imino-bis-naphthalin-2-sulfonsaeure |
| 2-Naphthalenesulfonic acid,7'-iminobis[4-hydroxy |
| 4,4'-dihydroxy-7,7'-imino-bis-naphthalene-2-sulfonic acid |
| 5.5'-Dioxy-(di-naphthyl-(2)-amin)-disulfonsaeure-(7.7') |
| J Acid Imide |
| 4,4'-dihydroxy-7,7'-iminodi(naphthalene-2-sulfonic acid) |
| Bis-(5-hydroxy-7-sulfo-naphthyl-(2))-amin |
| RW acid |
| EINECS 201-719-4 |
