Introduction：Basic information about CAS 147086-83-7|N-[(4S,6S)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]acet, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-[(4S,6S)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]acetamide |
|---|
| CAS Number | 147086-83-7 | Molecular Weight | 259.34500 |
|---|
| Density | 1.4 g/cm3 | Boiling Point | 530.919ºC at 760 mmHg |
|---|
| Molecular Formula | C10H13NO3S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 274.89ºC |
|---|
Names
| Name | N-(6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl)acetamide |
|---|
Chemical & Physical Properties
| Density | 1.4 g/cm3 |
|---|
| Boiling Point | 530.919ºC at 760 mmHg |
|---|
| Molecular Formula | C10H13NO3S2 |
|---|
| Molecular Weight | 259.34500 |
|---|
| Flash Point | 274.89ºC |
|---|
| Exact Mass | 259.03400 |
|---|
| PSA | 99.86000 |
|---|
| LogP | 2.96290 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.597 |
|---|
| InChIKey | WJXLCNFSFHSWMJ-RCOVLWMOSA-N |
|---|
| SMILES | CC(=O)NC1CC(C)S(=O)(=O)c2sccc21 |
|---|
