Introduction:Basic information about CAS 15667-10-4|1,1-bis(2-methylbutan-2-ylperoxy)cyclohexane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,1-bis(2-methylbutan-2-ylperoxy)cyclohexane |
|---|
| CAS Number | 15667-10-4 | Molecular Weight | 288.42300 |
|---|
| Density | 0.96g/cm3 | Boiling Point | 313.5ºC at 760mmHg |
|---|
| Molecular Formula | C16H32O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 111.9ºC |
|---|
| Symbol | GHS02, GHS07, GHS08 | Signal Word | Danger |
|---|
Names
| Name | 1,1-bis(2-methylbutan-2-ylperoxy)cyclohexane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.96g/cm3 |
|---|
| Boiling Point | 313.5ºC at 760mmHg |
|---|
| Molecular Formula | C16H32O4 |
|---|
| Molecular Weight | 288.42300 |
|---|
| Flash Point | 111.9ºC |
|---|
| Exact Mass | 288.23000 |
|---|
| PSA | 36.92000 |
|---|
| LogP | 4.92040 |
|---|
| Vapour Pressure | 0.000908mmHg at 25°C |
|---|
| Index of Refraction | n20/D 1.442 |
|---|
| InChIKey | IMYCVFRTNVMHAD-UHFFFAOYSA-N |
|---|
| SMILES | CCC(C)(C)OOC1(OOC(C)(C)CC)CCCCC1 |
|---|
Safety Information
| Symbol | GHS02, GHS07, GHS08 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H242-H304-H319-H332-H340-H350 |
|---|
| Precautionary Statements | P201-P210-P234-P261-P280-P308 + P313 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|
| Hazard Codes | O: Oxidizing agent;T: Toxic; |
|---|
| Risk Phrases | 8-65-36-7-45 |
|---|
| Safety Phrases | 7-17-62-47-45-36/37/39-26-14-53 |
|---|
| RIDADR | UN 3103 5.2 |
|---|
| HS Code | 2909600000 |
|---|
Customs
| HS Code | 2909600000 |
|---|
| Summary | 2909600000 alcohol peroxides, ether peroxides, ketone peroxides and their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| EINECS 239-741-1 |
| 1,1-Bis(tert-pentylperoxy)cyclohexane |
| MFCD01863712 |
| 1,1-di-(t-amylperoxy)-cyclohexane |
| 1,1-Bis-tert-pentylepioxy-cyclohexan |
| Cyclohexylidenebis(tert-amyl) peroxide |
| Cyclohexylidenebis(tert-pentyl)peroxide |
| 1,1-Bis(tert-amylperoxy)cyclohexane solution |
| 1,1-bis[(2-methylbutan-2-yl)peroxy]cyclohexane |