Introduction：Basic information about CAS 151721-35-6|n-(3-formylphenyl)benzenesulfonamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | n-(3-formylphenyl)benzenesulfonamide |
|---|
| CAS Number | 151721-35-6 | Molecular Weight | 261.29600 |
|---|
| Density | 1.373g/cm3 | Boiling Point | 436.4ºC at 760mmHg |
|---|
| Molecular Formula | C13H11NO3S | Melting Point | 104ºC |
|---|
| MSDS | / | Flash Point | 217.7ºC |
|---|
Names
| Name | n-(3-formylphenyl)benzenesulfonamide |
|---|
Chemical & Physical Properties
| Density | 1.373g/cm3 |
|---|
| Boiling Point | 436.4ºC at 760mmHg |
|---|
| Melting Point | 104ºC |
|---|
| Molecular Formula | C13H11NO3S |
|---|
| Molecular Weight | 261.29600 |
|---|
| Flash Point | 217.7ºC |
|---|
| Exact Mass | 261.04600 |
|---|
| PSA | 71.62000 |
|---|
| LogP | 3.45370 |
|---|
| Vapour Pressure | 8.1E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.644 |
|---|
| InChIKey | XYNPRCCUVAUTHD-UHFFFAOYSA-N |
|---|
| SMILES | O=Cc1cccc(NS(=O)(=O)c2ccccc2)c1 |
|---|
