Introduction:Basic information about CAS 129729-66-4|Emakalim, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Emakalim |
|---|
| CAS Number | 129729-66-4 | Molecular Weight | 296.32100 |
|---|
| Density | 1.34g/cm3 | Boiling Point | 523.9ºC at 760mmHg |
|---|
| Molecular Formula | C17H16N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 270.6ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.34g/cm3 |
|---|
| Boiling Point | 523.9ºC at 760mmHg |
|---|
| Molecular Formula | C17H16N2O3 |
|---|
| Molecular Weight | 296.32100 |
|---|
| Flash Point | 270.6ºC |
|---|
| Exact Mass | 296.11600 |
|---|
| PSA | 75.25000 |
|---|
| LogP | 1.84128 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.65 |
|---|
| InChIKey | MMSFHQSHXRMPLJ-CVEARBPZSA-N |
|---|
| SMILES | CC1(C)Oc2ccc(C#N)cc2C(n2ccccc2=O)C1O |
|---|