Introduction：Basic information about CAS 55837-28-0|Tiafibrate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tiafibrate |
|---|
| CAS Number | 55837-28-0 | Molecular Weight | 687.77700 |
|---|
| Density | 1.17g/cm3 | Boiling Point | 726.1ºC at 760mmHg |
|---|
| Molecular Formula | C34H48Cl2O6S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 392.9ºC |
|---|
Names
| Name | 2-[10-[2-[2-(4-chlorophenoxy)-2-methylpropanoyl]oxyethylsulfanyl]decylsulfanyl]ethyl 2-(4-chlorophenoxy)-2-methylpropanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.17g/cm3 |
|---|
| Boiling Point | 726.1ºC at 760mmHg |
|---|
| Molecular Formula | C34H48Cl2O6S2 |
|---|
| Molecular Weight | 687.77700 |
|---|
| Flash Point | 392.9ºC |
|---|
| Exact Mass | 686.22700 |
|---|
| PSA | 121.66000 |
|---|
| LogP | 9.68200 |
|---|
| Index of Refraction | 1.545 |
|---|
| InChIKey | RSLQBRWTDJTEHT-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(Oc1ccc(Cl)cc1)C(=O)OCCSCCCCCCCCCCSCCOC(=O)C(C)(C)Oc1ccc(Cl)cc1 |
|---|
Synonyms
| Tiafibrate |
| Tiafibrate [INN] |
