Introduction：Basic information about CAS 87646-83-1|Lodazecar, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Lodazecar |
|---|
| CAS Number | 87646-83-1 | Molecular Weight | 523.80700 |
|---|
| Density | 1.54g/cm3 | Boiling Point | 728.1ºC at 760 mmHg |
|---|
| Molecular Formula | C22H24BrClN4O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 394.2ºC |
|---|
Names
| Name | 1-[(3S)-6-bromo-5-(2-chlorophenyl)-1,3-dimethyl-2-oxo-3H-1,4-benzodiazepin-7-yl]-3-(1,3-dihydroxy-2-methylpropan-2-yl)urea |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.54g/cm3 |
|---|
| Boiling Point | 728.1ºC at 760 mmHg |
|---|
| Molecular Formula | C22H24BrClN4O4 |
|---|
| Molecular Weight | 523.80700 |
|---|
| Flash Point | 394.2ºC |
|---|
| Exact Mass | 522.06700 |
|---|
| PSA | 114.26000 |
|---|
| LogP | 3.13410 |
|---|
| Index of Refraction | 1.657 |
|---|
| InChIKey | DEYVHVVHCGGWLZ-LBPRGKRZSA-N |
|---|
| SMILES | CC1N=C(c2ccccc2Cl)c2c(ccc(NC(=O)NC(C)(CO)CO)c2Br)N(C)C1=O |
|---|
Synonyms
| Lodazecar [INN] |
| Urea,N-(6-bromo-5-(2-chlorophenyl)-2,3-dihydro-1,3-dimethyl-2-oxo-1H-1,4-benzodiazepin-7-yl)-N'-(2-hydroxy-1-(hydroxymethyl)-1-methylethyl)-,(S) |
| Ro 16-0521 |
| Lodazecarum |
| 1-(1,1-Bis(hydroxymethyl)ethyl)-3-((S)-6-bromo-5-(o-chlorophenyl)-2,3-dihydro-1,3-dimethyl-2-oxo-1H-1,4-benzodiazepin-7-yl)urea |
| Lodazecar |
| Lodazecarum [Latin] |
