Introduction:Basic information about CAS 5397-76-2|Methanone,4-morpholinyl(4-nitrophenyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methanone,4-morpholinyl(4-nitrophenyl)- |
|---|
| CAS Number | 5397-76-2 | Molecular Weight | 236.22400 |
|---|
| Density | 1.331g/cm3 | Boiling Point | 443.6ºC at 760 mmHg |
|---|
| Molecular Formula | C11H12N2O4 | Melting Point | 100-103ºC |
|---|
| MSDS | / | Flash Point | 222.1ºC |
|---|
Names
| Name | morpholin-4-yl-(4-nitrophenyl)methanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.331g/cm3 |
|---|
| Boiling Point | 443.6ºC at 760 mmHg |
|---|
| Melting Point | 100-103ºC |
|---|
| Molecular Formula | C11H12N2O4 |
|---|
| Molecular Weight | 236.22400 |
|---|
| Flash Point | 222.1ºC |
|---|
| Exact Mass | 236.08000 |
|---|
| PSA | 75.36000 |
|---|
| LogP | 1.52830 |
|---|
| Index of Refraction | 1.589 |
|---|
| InChIKey | VGGZQWDRWOXJTA-UHFFFAOYSA-N |
|---|
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)N1CCOCC1 |
|---|
Safety Information
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| N-(4-nitrobenzoyl)morpholine |
| methanone,4-morpholinyl(4-nitrophenyl) |
| morpholin-4-yl 4-nitrophenyl ketone |
| 4-Nitrobenzoic acid,morpholide |
| 4-(4-nitrobenzoyl)morpholine |
| 1-morpholin-4-yl-1-(4-nitro-phenyl)-methanone |
| morpholino(4-nitrophenyl)methanone |
| F0808-1096 |
| morpholino(4-nitrophenyl)methanon |
| 4-(p-nitrobenzoyl)morpholine |
| (4-nitrophenyl)-morpholin-4-ylmethanone |