Introduction:Basic information about CAS 5367-52-2|N~1~,N~1~-dimethyl-4-nitro-1,2-benzenediamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N~1~,N~1~-dimethyl-4-nitro-1,2-benzenediamine |
|---|
| CAS Number | 5367-52-2 | Molecular Weight | 181.19200 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C8H11N3O2 | Melting Point | 58-60ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1-N,1-N-dimethyl-4-nitrobenzene-1,2-diamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 58-60ºC |
|---|
| Molecular Formula | C8H11N3O2 |
|---|
| Molecular Weight | 181.19200 |
|---|
| Exact Mass | 181.08500 |
|---|
| PSA | 75.08000 |
|---|
| LogP | 2.34740 |
|---|
| InChIKey | ADPVQLSOQDWABD-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)c1ccc([N+](=O)[O-])cc1N |
|---|
Safety Information
Customs
| HS Code | 2921590090 |
|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2-Dimethylamino-5-nitro-anilin |
| N1.N1-Dimethyl-4-nitro-phenylendiamin-(1.2) |
| 2-dimethylamino-5-nitroaniline |
| N1,N1-dimethyl-4-nitro-o-phenylenediamine |
| N1,N1-Dimethyl-4-nitro-o-phenylendiamin |
| dimethylnitrobenzenediamine |
| 4-Nitro-2-amino-dimethylanilin |
| N~1~,N~1~-dimethyl-4-nitro-1,2-benzenediamine |