Introduction：Basic information about CAS 14202-14-3|3,5-Dimethyl-1-adamantaneacetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,5-Dimethyl-1-adamantaneacetic acid |
|---|
| CAS Number | 14202-14-3 | Molecular Weight | 222.323 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 339.2±10.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H22O2 | Melting Point | 110-115°C |
|---|
| MSDS | ChineseUSA | Flash Point | 166.8±10.3 °C |
|---|
Names
| Name | 2-(3,5-dimethyl-1-adamantyl)acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 339.2±10.0 °C at 760 mmHg |
|---|
| Melting Point | 110-115°C |
|---|
| Molecular Formula | C14H22O2 |
|---|
| Molecular Weight | 222.323 |
|---|
| Flash Point | 166.8±10.3 °C |
|---|
| Exact Mass | 222.161987 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 4.09 |
|---|
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.548 |
|---|
| InChIKey | FUOXJVUIQUYDDI-UHFFFAOYSA-N |
|---|
| SMILES | CC12CC3CC(C)(C1)CC(CC(=O)O)(C3)C2 |
|---|
Safety Information
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2916209090 |
|---|
Customs
| HS Code | 2916209090 |
|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2-(3,5-Dimethyladamantan-1-yl)acetic acid |
| 3,5-Dimethyladamantane-1-acetic acid |
| acide dimethyl-3,5 adamantylacetique |
| 3,5-dimethyladamantyl-1-acetic acid |
| 3,5-Dimethyl-1-adamantaneacetic acid |
| 3,5-Dimethyl-adamantan-essigsaeure-(1) |
| 3,7-DIMETHYL-1-ADAMANTANEACETIC ACID |
| Tricyclo[3.3.1.1]decane-1-acetic acid, 3,5-dimethyl-, (3R,5S)- |
| [(1r,3R,5S,7r)-3,5-Dimethyladamantan-1-yl]acetic acid |
| (3,5-dimethyl-adamantan-1-yl)-acetic acid |
| 3,5-Dimethyltricyclo[3.3.1.13,7]decane-1-acetic acid |
| (3,5-Dimethyl-adamantyl)-essigsaeure |
| 2-(3,5-dimethyladamantanyl)acetic acid |
| (3,5-dimethyltricyclo[3.3.1.1~3,7~]dec-1-yl)acetic acid |
| 3,5-dimethyl-1-adamantylacetic acid |
