Introduction:Basic information about CAS 755030-85-4|4-(chloroMethyl)-2-(3-Methoxyphenyl)-5-Methyl-1,3-oxazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(chloroMethyl)-2-(3-Methoxyphenyl)-5-Methyl-1,3-oxazole |
|---|
| CAS Number | 755030-85-4 | Molecular Weight | 237.68200 |
|---|
| Density | 1.196g/cm3 | Boiling Point | 384.972ºC at 760 mmHg |
|---|
| Molecular Formula | C12H12ClNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 186.624ºC |
|---|
Names
| Name | 4-(chloroMethyl)-2-(3-Methoxyphenyl)-5-Methyl-1,3-oxazole |
|---|
Chemical & Physical Properties
| Density | 1.196g/cm3 |
|---|
| Boiling Point | 384.972ºC at 760 mmHg |
|---|
| Molecular Formula | C12H12ClNO2 |
|---|
| Molecular Weight | 237.68200 |
|---|
| Flash Point | 186.624ºC |
|---|
| Exact Mass | 237.05600 |
|---|
| PSA | 35.26000 |
|---|
| LogP | 3.39740 |
|---|
| Index of Refraction | 1.542 |
|---|
| InChIKey | VWFGBAZRKXYFCO-UHFFFAOYSA-N |
|---|
| SMILES | COc1cccc(-c2nc(CCl)c(C)o2)c1 |
|---|