Introduction:Basic information about CAS 117770-66-8|tert-Butyl 3S-amino-2,3,4,5-tetrahydro-1H-[1]benaepin-2-one-1acetate-tartrate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tert-Butyl 3S-amino-2,3,4,5-tetrahydro-1H-[1]benaepin-2-one-1acetate-tartrate |
|---|
| CAS Number | 117770-66-8 | Molecular Weight | 440.444 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C20H28N2O9 | Melting Point | 190ºC (DEC.) |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | tert-butyl 2-(3-amino-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)acetate,2,3-dihydroxybutanedioic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 190ºC (DEC.) |
|---|
| Molecular Formula | C20H28N2O9 |
|---|
| Molecular Weight | 440.444 |
|---|
| Exact Mass | 440.179474 |
|---|
| PSA | 187.69000 |
|---|
| LogP | 0.27750 |
|---|
| InChIKey | DLYKUHWZMNJPSM-WDAIIGIFSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)CN1C(=O)C(N)CCc2ccccc21.O=C(O)C(O)C(O)C(=O)O |
|---|
Synonyms
| (3-Amino-2-oxo-2,3,4,5-tetrahydro-benzo[b]azepin-1-yl)-acetic acid tert-butyl ester |
| (2R,3R)-2,3-Dihydroxysuccinic acid - 2-methyl-2-propanyl [(3S)-3-amino-2-oxo-2,3,4,5-tetrahydro-1H-1-benzazepin-1-yl]acetate (1:1) |
| compound with 2,3-dihydroxy-succinic acid |
| T-Butyl 3s-amino-2,3,4,5-tetrahydro-1h-1benaepin-2-one-1-acetate-tartrate |
| 1H-1-Benzazepine-1-acetic acid, 3-amino-2,3,4,5-tetrahydro-2-oxo-, 1,1-dimethylethyl ester, (3S)-, compd. with (2R,3R)-2,3-dihydroxybutanedioic acid (1:1) |