Introduction：Basic information about CAS 438230-66-1|4-ethyl-3-(5-methylthiophen-3-yl)-1H-1,2,4-triazole-5-thione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-ethyl-3-(5-methylthiophen-3-yl)-1H-1,2,4-triazole-5-thione |
|---|
| CAS Number | 438230-66-1 | Molecular Weight | 225.33400 |
|---|
| Density | 1.38g/cm3 | Boiling Point | 314.6ºC at 760 mmHg |
|---|
| Molecular Formula | C9H11N3S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 144.1ºC |
|---|
Names
| Name | 4-ethyl-3-(5-methylthiophen-3-yl)-1H-1,2,4-triazole-5-thione |
|---|
Chemical & Physical Properties
| Density | 1.38g/cm3 |
|---|
| Boiling Point | 314.6ºC at 760 mmHg |
|---|
| Molecular Formula | C9H11N3S2 |
|---|
| Molecular Weight | 225.33400 |
|---|
| Flash Point | 144.1ºC |
|---|
| Exact Mass | 225.03900 |
|---|
| PSA | 97.75000 |
|---|
| LogP | 2.62360 |
|---|
| Index of Refraction | 1.715 |
|---|
| InChIKey | YPRAIHQGMMEDAG-UHFFFAOYSA-N |
|---|
| SMILES | CCn1c(-c2csc(C)c2)n[nH]c1=S |
|---|
