Introduction：Basic information about CAS 539807-29-9|3-[(dimethylsulfamoyl)amino]phenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-[(dimethylsulfamoyl)amino]phenol |
|---|
| CAS Number | 539807-29-9 | Molecular Weight | 216.25700 |
|---|
| Density | 1.422g/cm3 | Boiling Point | 365.31ºC at 760 mmHg |
|---|
| Molecular Formula | C8H12N2O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 174.733ºC |
|---|
Names
| Name | 1-(dimethylsulfamoylamino)-3-hydroxybenzene |
|---|
Chemical & Physical Properties
| Density | 1.422g/cm3 |
|---|
| Boiling Point | 365.31ºC at 760 mmHg |
|---|
| Molecular Formula | C8H12N2O3S |
|---|
| Molecular Weight | 216.25700 |
|---|
| Flash Point | 174.733ºC |
|---|
| Exact Mass | 216.05700 |
|---|
| PSA | 78.02000 |
|---|
| LogP | 1.76430 |
|---|
| Index of Refraction | 1.627 |
|---|
| InChIKey | AHZQSWQALJXNQV-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)S(=O)(=O)Nc1cccc(O)c1 |
|---|
