Introduction:Basic information about CAS 851322-37-7|3,9-Diazaspiro[5.5]undecane-3-carboxylic acid, 9-benzoyl-, 1,1-dimethylethyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,9-Diazaspiro[5.5]undecane-3-carboxylic acid, 9-benzoyl-, 1,1-dimethylethyl ester |
|---|
| CAS Number | 851322-37-7 | Molecular Weight | 358.47500 |
|---|
| Density | 1.15g/cm3 | Boiling Point | 497ºC at 760 mmHg |
|---|
| Molecular Formula | C21H30N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 254.4ºC |
|---|
Names
| Name | 3,9-Diazaspiro[5.5]undecane-3-carboxylic acid, 9-benzoyl-, 1,1-dimethylethyl ester |
|---|
Chemical & Physical Properties
| Density | 1.15g/cm3 |
|---|
| Boiling Point | 497ºC at 760 mmHg |
|---|
| Molecular Formula | C21H30N2O3 |
|---|
| Molecular Weight | 358.47500 |
|---|
| Flash Point | 254.4ºC |
|---|
| Exact Mass | 358.22600 |
|---|
| PSA | 49.85000 |
|---|
| LogP | 3.81570 |
|---|
| Index of Refraction | 1.567 |
|---|
| InChIKey | FRWVGLPTIBIIGW-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CCN(C(=O)c1ccccc1)CC2 |
|---|