Introduction：Basic information about CAS 7004-98-0|(16α,17α)-3-Methoxyestra-1,3,5(10)-triene-16,17-diol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (16α,17α)-3-Methoxyestra-1,3,5(10)-triene-16,17-diol |
|---|
| CAS Number | 7004-98-0 | Molecular Weight | 302.40800 |
|---|
| Density | 1.185g/cm3 | Boiling Point | 450.8ºC at 760 mmHg |
|---|
| Molecular Formula | C19H26O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 226.4ºC |
|---|
Names
| Name | 3-Methoxyestra-1,3,5(10)-triene-16.α.,17.α.-diol |
|---|
Chemical & Physical Properties
| Density | 1.185g/cm3 |
|---|
| Boiling Point | 450.8ºC at 760 mmHg |
|---|
| Molecular Formula | C19H26O3 |
|---|
| Molecular Weight | 302.40800 |
|---|
| Flash Point | 226.4ºC |
|---|
| Exact Mass | 302.18800 |
|---|
| PSA | 49.69000 |
|---|
| LogP | 2.88300 |
|---|
| Index of Refraction | 1.588 |
|---|
| InChIKey | UHQGCIIQUZBJAE-RRQVMCLOSA-N |
|---|
| SMILES | COc1ccc2c(c1)CCC1C2CCC2(C)C(O)C(O)CC12 |
|---|
