Introduction：Basic information about CAS 19407-42-2|2-acetamido-6-chlorobenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-acetamido-6-chlorobenzoic acid |
|---|
| CAS Number | 19407-42-2 | Molecular Weight | 213.61800 |
|---|
| Density | 1.453g/cm3 | Boiling Point | 429.5ºC at 760mmHg |
|---|
| Molecular Formula | C9H8ClNO3 | Melting Point | 216-218°C |
|---|
| MSDS | USA | Flash Point | 213.5ºC |
|---|
Names
| Name | 2-acetamido-6-chlorobenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.453g/cm3 |
|---|
| Boiling Point | 429.5ºC at 760mmHg |
|---|
| Melting Point | 216-218°C |
|---|
| Molecular Formula | C9H8ClNO3 |
|---|
| Molecular Weight | 213.61800 |
|---|
| Flash Point | 213.5ºC |
|---|
| Exact Mass | 213.01900 |
|---|
| PSA | 66.40000 |
|---|
| LogP | 2.06960 |
|---|
| Vapour Pressure | 3.87E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.63 |
|---|
| InChIKey | VFHSJTHAMJFUCK-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Nc1cccc(Cl)c1C(=O)O |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 6-Chlor-2-acetamino-benzoesaeure |
| MFCD00051939 |
| 2-chloro-6-acetamidobenzoic acid |
| N-Acetyl-6-chlor-anthranilsaeure |
| EINECS 243-040-6 |
| 2-Acetylamino-6-chlor-benzoesaeure |
