Introduction:Basic information about CAS 3078-09-9|Benzaldehyde,2-(4-nitrophenyl)hydrazone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzaldehyde,2-(4-nitrophenyl)hydrazone |
|---|
| CAS Number | 3078-09-9 | Molecular Weight | 241.24500 |
|---|
| Density | 1.2g/cm3 | Boiling Point | 410.4ºC at 760mmHg |
|---|
| Molecular Formula | C13H11N3O2 | Melting Point | 195 °C |
|---|
| MSDS | ChineseUSA | Flash Point | 202ºC |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | benzaldehyde 4-nitrophenylhydrazone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2g/cm3 |
|---|
| Boiling Point | 410.4ºC at 760mmHg |
|---|
| Melting Point | 195 °C |
|---|
| Molecular Formula | C13H11N3O2 |
|---|
| Molecular Weight | 241.24500 |
|---|
| Flash Point | 202ºC |
|---|
| Exact Mass | 241.08500 |
|---|
| PSA | 70.21000 |
|---|
| LogP | 3.63700 |
|---|
| Index of Refraction | 1.608 |
|---|
| InChIKey | NOIFWEYOLLHIMW-GXDHUFHOSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(NN=Cc2ccccc2)cc1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xn: Harmful; |
|---|
| Risk Phrases | 22-36/37/38 |
|---|
| Safety Phrases | S26 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| Benzaldehyde,(p-nitrophenyl)hydrazone (8ci) |
| Benzal-4-nitrophenylhydrazone |
| (4-nitrophenylhydrazono)(phenyl)methane |
| N-benzylidene-N'-(3-nitrophenyl) hydrazine |
| Benzaldehyde,2-(4-nitrophenyl)hydrazone |
| benzaldehyde-(4-nitro-phenylhydrazone) |
| MFCD00024596 |
| N-benzylidene-N'-(4-nitrophenyl)hydrazine |
| (3-nitrophenyl hydrazono)(phenyl) methane |
| BENZALDEHYDE (4-NITROPHENYL)HYDRAZONE |
| BENZALDEHYDE P-NITROPHENYL-HYDRAZONE |