Introduction：Basic information about CAS 14458-05-0|2,3,5,6-tetramethylterephthalic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,3,5,6-tetramethylterephthalic acid |
|---|
| CAS Number | 14458-05-0 | Molecular Weight | 222.23700 |
|---|
| Density | 1.237g/cm3 | Boiling Point | 402.6ºC at 760mmHg |
|---|
| Molecular Formula | C12H14O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 211.4ºC |
|---|
Names
| Name | 2,3,5,6-tetramethylterephthalic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.237g/cm3 |
|---|
| Boiling Point | 402.6ºC at 760mmHg |
|---|
| Molecular Formula | C12H14O4 |
|---|
| Molecular Weight | 222.23700 |
|---|
| Flash Point | 211.4ºC |
|---|
| Exact Mass | 222.08900 |
|---|
| PSA | 74.60000 |
|---|
| LogP | 2.31660 |
|---|
| Vapour Pressure | 3.33E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.575 |
|---|
| InChIKey | NEOZDUDLYDUOTE-UHFFFAOYSA-N |
|---|
| SMILES | Cc1c(C)c(C(=O)O)c(C)c(C)c1C(=O)O |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2917399090 |
|---|
Customs
| HS Code | 2917399090 |
|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 2,3,5,6-tetramethyl-1,4-benzenedicarboxylate |
| tetramethylterephthalic acid |
| 2,3,5,6-tetramethyl-1,4-benzenedicarboxylic acid |
| 2,3,5,6-tetramethylbenzene-1,4-dicarboxylic acid |
