Introduction：Basic information about CAS 351336-16-8|5-(2-Formyl-phenoxymethyl)-furan-2-carboxylic acid methyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(2-Formyl-phenoxymethyl)-furan-2-carboxylic acid methyl ester |
|---|
| CAS Number | 351336-16-8 | Molecular Weight | 260.24200 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C14H12O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 5-(2-Formyl-phenoxymethyl)-furan-2-carboxylic acid methyl ester |
|---|
Chemical & Physical Properties
| Molecular Formula | C14H12O5 |
|---|
| Molecular Weight | 260.24200 |
|---|
| Exact Mass | 260.06800 |
|---|
| PSA | 65.74000 |
|---|
| LogP | 2.45770 |
|---|
| InChIKey | SKQZGCQIJHCKTI-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1ccc(COc2ccccc2C=O)o1 |
|---|
Safety Information
Customs
| HS Code | 2932190090 |
|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
