Introduction：Basic information about CAS 91368-74-0|5-(Phenoxymethyl)-2-furoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(Phenoxymethyl)-2-furoic acid |
|---|
| CAS Number | 91368-74-0 | Molecular Weight | 218.20500 |
|---|
| Density | 1.287g/cm3 | Boiling Point | 391.3ºC at 760mmHg |
|---|
| Molecular Formula | C12H10O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 190.5ºC |
|---|
Names
| Name | 5-(Phenoxymethyl)-2-furoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.287g/cm3 |
|---|
| Boiling Point | 391.3ºC at 760mmHg |
|---|
| Molecular Formula | C12H10O4 |
|---|
| Molecular Weight | 218.20500 |
|---|
| Flash Point | 190.5ºC |
|---|
| Exact Mass | 218.05800 |
|---|
| PSA | 59.67000 |
|---|
| LogP | 2.55680 |
|---|
| Index of Refraction | 1.583 |
|---|
| InChIKey | KPSLIMYRDNBEGK-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccc(COc2ccccc2)o1 |
|---|
Synonyms
| 4-phenyl-5-(phenoxymethyl)-1,2,4-triazole-3-thiol |
| 5-phenoxymethyl-furan-2-carboxylic acid |
| 5-Phenoxymethyl-4-phenyl-3-mercapto-triazol |
| 5-phenoxymethyl-4-phenyl-2,4-dihydro-[1,2,4]triazole-3-thione |
| 5-Phenoxymethyl-furan-carbonsaeure-(2) |
| 5-Phenoxymethyl-4-phenyl-4H |
| 5-Phenoxymethyl-4-phenyl-4H-[1,2,4]triazole-3-thiol |
