Introduction：Basic information about CAS 40546-94-9|6-Methyl-4-phenyl-2-chromanone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Methyl-4-phenyl-2-chromanone |
|---|
| CAS Number | 40546-94-9 | Molecular Weight | 238.281 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 351.1±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H14O2 | Melting Point | 68-70ºC |
|---|
| MSDS | / | Flash Point | 146.3±25.3 °C |
|---|
Names
| Name | 6-Methyl-4-phenylchroman-2-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 351.1±42.0 °C at 760 mmHg |
|---|
| Melting Point | 68-70ºC |
|---|
| Molecular Formula | C16H14O2 |
|---|
| Molecular Weight | 238.281 |
|---|
| Flash Point | 146.3±25.3 °C |
|---|
| Exact Mass | 238.099380 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 3.63 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.595 |
|---|
| InChIKey | SUHIZPDCJOQZLN-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc2c(c1)C(c1ccccc1)CC(=O)O2 |
|---|
| Storage condition | Refrigerator |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2932209090 |
|---|
Customs
| HS Code | 2932209090 |
|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 3,4-dihydro-6-methyl-4-phenyl-2H-benzopyran-2-one |
| 6-Methy1-4-phenyl-chroMan-2-one |
| 6-Methyl-4-phenyl-3,4-dihydrovanillin |
| 3,4-Dihydro-6-methyl-4-phenylcoumarin |
| 3,4-Dihydro-6-methyl-4-phenyl-2H-1-benzopyran-2-one |
| forTolterodine-L-tartrate |
| 6-Methyl-4-phenyl-chroman-2-on |
| 6-METHYL-4-PHENYL-CHROMAN-ONE |
| 6-Methyl-4-phenyl-2-chromanone |
| 6-methyl-4-phenyl-3,4-dihydrobenzopyran-2-one |
| 6-METHYL-4-PHENYL-3,4-DIHYDRO-2H-1-BENZOPYRAN |
| 6-methyl-4-phenyl-3,4-dihydrocoumarin |
| MFCD03695019 |
| 2H-1-Benzopyran-2-one, 3,4-dihydro-6-methyl-4-phenyl- |
| 6-Methyl-4-phenylchroman-2-one |
| 6-methyl-4-phenyl-chroman-2-one |
| Dihydro methyl phenyl benzopyran one |
| rac-6-Methyl-4-phenylchroMan-2-one |
