Introduction:Basic information about CAS 301673-16-5|4-N-Boc-2-hydroxyMethylpiperazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-N-Boc-2-hydroxyMethylpiperazine |
|---|
| CAS Number | 301673-16-5 | Molecular Weight | 216.277 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 322.9±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H20N2O3 | Melting Point | 95 °C |
|---|
| MSDS | USA | Flash Point | 149.1±22.3 °C |
|---|
Names
| Name | tert-butyl 3-(hydroxymethyl)piperazine-1-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 322.9±22.0 °C at 760 mmHg |
|---|
| Melting Point | 95 °C |
|---|
| Molecular Formula | C10H20N2O3 |
|---|
| Molecular Weight | 216.277 |
|---|
| Flash Point | 149.1±22.3 °C |
|---|
| Exact Mass | 216.147400 |
|---|
| PSA | 61.80000 |
|---|
| LogP | -0.19 |
|---|
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.478 |
|---|
| InChIKey | NSILYQWHARROMG-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1CCNC(CO)C1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| HS Code | 2933599090 |
|---|
Customs
| HS Code | 2933599090 |
|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2-Methyl-2-propanyl (3R)-3-(hydroxymethyl)-1-piperazinecarboxylate |
| 4-N-Boc-2-hydroxymethylpiperazine |
| 3-(hydroxymethyl)-1-piperazinecarboxylic acid,1,1-dimethylethyl ester |
| tert-Butyl 3-(hydroxymethyl)piperazine-1-carboxylate |
| MFCD04115304 |
| 2-Methyl-2-propanyl 3-(hydroxymethyl)-1-piperazinecarboxylate |
| 1-N-Boc-3-Hydroxymethypiperazine |
| 3-(R)-hydroxymethyl-piperazine-1-carboxylic acid tert-butyl ester |
| 1,1-dimethylethyl 3-(hydroxymethyl)-1-piperazinecarboxylate |
| tert-Butyl-(3R)-3-(hydroxymethyl)piperazin-1-carboxylat |
| 1-Boc-(3-Hydroxymethyl)piperazine |
| 1-Piperazinecarboxylic acid, 3-(hydroxymethyl)-, 1,1-dimethylethyl ester, (3R)- |
| 3-Hydroxymethyl-piperazine-1-carboxylic acid tert-butyl ester |
| 1-(tert.butyloxycarbonyl)-3-hydroxymethyl-piperazine |
| tert-butyl (3R)-3-(hydroxymethyl)piperazine-1-carboxylate |
| 1-Boc-3-(hydroxymethyl)piperazine |