Introduction：Basic information about CAS 438631-77-7|(R)-1-tert-Butyl 3-methyl piperazine-1,3-dicarboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (R)-1-tert-Butyl 3-methyl piperazine-1,3-dicarboxylate |
|---|
| CAS Number | 438631-77-7 | Molecular Weight | 244.288 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 321.3±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H20N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 148.1±26.5 °C |
|---|
Names
| Name | 1-O-tert-butyl 3-O-methyl (3R)-piperazine-1,3-dicarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 321.3±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H20N2O4 |
|---|
| Molecular Weight | 244.288 |
|---|
| Flash Point | 148.1±26.5 °C |
|---|
| Exact Mass | 244.142303 |
|---|
| PSA | 67.87000 |
|---|
| LogP | 0.73 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.472 |
|---|
| InChIKey | QUKAHFCVKNRRBU-MRVPVSSYSA-N |
|---|
| SMILES | COC(=O)C1CN(C(=O)OC(C)(C)C)CCN1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2933599090 |
|---|
Customs
| HS Code | 2933599090 |
|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 3-methyl piperazine-1,3-dicarboxylic acid 1-tert-butyl ester |
| 3-Methyl 1-(2-methyl-2-propanyl) (3R)-1,3-piperazinedicarboxylate |
| 1,3-Piperazinedicarboxylic acid,1-(1,1-dimethylethyl) 3-methyl ester,(3R) |
| (R)-4-tert-butyloxypiperazine-2-carboxylic acid methyl ester |
| 1-tert-butyl 3-methyl (3r)-piperazine-1,3-dicarboxylate |
| (R)-4N-boc-piperazine 2-carboxylic acid methyl ester |
| (r)-1-tert-butyl 3-methyl piperazine-1,3-dicarboxylate |
| (r)-1-n-boc-piperazine-3-carboxylic acid methyl ester |
| (r)-piperazine-1,3-dicarboxylic acid 1-tert-butyl ester 3-methyl ester |
| Methyl (R)-1-N-Boc-piperazine-3-carboxylate |
| 3-Methyl 1-(2-methyl-2-propanyl) 1,3-piperazinedicarboxylate |
| Methyl(R)-4-Boc-piperazine-2-carboxylate |
| (R)-1-N-Boc-piperazine-3-carboxylicacid methylester |
